C17H22FN3O4 — CID 135117414
3-(dimethylamino)-5-(4-fluoro-3-methoxyphenyl)-N-(4-hydroxybutyl)-1,2-oxazole-4-carboxamide (PubChem CID 135117414) has the molecular formula C17H22FN3O4 and a molecular weight of 351.38 g/mol. Its IUPAC name is 3-(dimethylamino)-5-(4-fluoro-3-methoxyphenyl)-N-(4-hydroxybutyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(dimethylamino)-5-(4-fluoro-3-methoxyphenyl)-N-(4-hydroxybutyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 135117414 |
| Molecular Formula | C17H22FN3O4 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 3-(dimethylamino)-5-(4-fluoro-3-methoxyphenyl)-N-(4-hydroxybutyl)-1,2-oxazole-4-carboxamide |
| SMILES | COc1cc(-c2onc(N(C)C)c2C(=O)NCCCCO)ccc1F |
| InChI | InChI=1S/C17H22FN3O4/c1-21(2)16-14(17(23)19-8-4-5-9-22)15(25-20-16)11-6-7-12(18)13(10-11)24-3/h6-7,10,22H,4-5,8-9H2,1-3H3,(H,19,23) |
| InChIKey | PCOAOXGYKQZRCR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 87.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|