C21H22N4O3 — CID 135118508
[(3S,4R)-3-hydroxy-4-(quinolin-4-ylmethyl)pyrrolidin-1-yl]-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)methanone (PubChem CID 135118508) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is [(3S,4R)-3-hydroxy-4-(quinolin-4-ylmethyl)pyrrolidin-1-yl]-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)methanone.
| Compound Name | [(3S,4R)-3-hydroxy-4-(quinolin-4-ylmethyl)pyrrolidin-1-yl]-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 135118508 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | [(3S,4R)-3-hydroxy-4-(quinolin-4-ylmethyl)pyrrolidin-1-yl]-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)methanone |
| SMILES | O=C(c1n[nH]c2c1COCC2)N1C[C@@H](Cc2ccnc3ccccc23)[C@H](O)C1 |
| InChI | InChI=1S/C21H22N4O3/c26-19-11-25(21(27)20-16-12-28-8-6-18(16)23-24-20)10-14(19)9-13-5-7-22-17-4-2-1-3-15(13)17/h1-5,7,14,19,26H,6,8-12H2,(H,23,24)/t14-,19-/m1/s1 |
| InChIKey | CMAUYFKTQZYTAM-AUUYWEPGSA-N |
| XLogP | 1.71 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |