About 4-chloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-1-methylpyrazole-3-carboxamide
4-chloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-1-methylpyrazole-3-carboxamide (PubChem CID 135119969) has the molecular formula C12H19ClN4O4S
and a molecular weight of 350.83 g/mol. Its IUPAC name is 4-chloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-1-methylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-1-methylpyrazole-3-carboxamide |
| PubChem CID | 135119969 |
| Molecular Formula | C12H19ClN4O4S |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 4-chloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-1-methylpyrazole-3-carboxamide |
| SMILES | CN(C)S(=O)(=O)C[C@@H]1COC[C@@H]1NC(=O)c1nn(C)cc1Cl |
| InChI | InChI=1S/C12H19ClN4O4S/c1-16(2)22(19,20)7-8-5-21-6-10(8)14-12(18)11-9(13)4-17(3)15-11/h4,8,10H,5-7H2,1-3H3,(H,14,18)/t8-,10-/m0/s1 |
| InChIKey | NQIDVPFHBJDEGV-WPRPVWTQSA-N |
| XLogP | -0.29 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-chloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-1-methylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-1-methylpyrazole-3-carboxamide?
The IUPAC name of 4-chloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-1-methylpyrazole-3-carboxamide (CID 135119969) is 4-chloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-1-methylpyrazole-3-carboxamide.
What is the SMILES notation for 4-chloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-1-methylpyrazole-3-carboxamide?
The canonical SMILES for 4-chloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-1-methylpyrazole-3-carboxamide is CN(C)S(=O)(=O)C[C@@H]1COC[C@@H]1NC(=O)c1nn(C)cc1Cl.
What is the InChIKey of 4-chloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-1-methylpyrazole-3-carboxamide?
The InChIKey is NQIDVPFHBJDEGV-WPRPVWTQSA-N. The full InChI is InChI=1S/C12H19ClN4O4S/c1-16(2)22(19,20)7-8-5-21-6-10(8)14-12(18)11-9(13)4-17(3)15-11/h4,8,10H,5-7H2,1-3H3,(H,14,18)/t8-,10-/m0/s1.
What are the key properties of 4-chloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-1-methylpyrazole-3-carboxamide?
4-chloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-1-methylpyrazole-3-carboxamide has a molecular weight of 350.83 g/mol, XLogP of -0.29, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-1-methylpyrazole-3-carboxamide is sourced from PubChem (CID 135119969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).