C17H7ClF3N5O4 — CID 135121125
3-chloro-5-[1-[(5,6-dioxopyridazin-3-yl)methyl]-6-oxo-4-(trifluoromethyl)pyrimidin-5-yl]oxybenzonitrile (PubChem CID 135121125) has the molecular formula C17H7ClF3N5O4 and a molecular weight of 437.72 g/mol. Its IUPAC name is 3-chloro-5-[1-[(5,6-dioxopyridazin-3-yl)methyl]-6-oxo-4-(trifluoromethyl)pyrimidin-5-yl]oxybenzonitrile.
| Compound Name | 3-chloro-5-[1-[(5,6-dioxopyridazin-3-yl)methyl]-6-oxo-4-(trifluoromethyl)pyrimidin-5-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 135121125 |
| Molecular Formula | C17H7ClF3N5O4 |
| Molecular Weight | 437.72 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | 3-chloro-5-[1-[(5,6-dioxopyridazin-3-yl)methyl]-6-oxo-4-(trifluoromethyl)pyrimidin-5-yl]oxybenzonitrile |
| SMILES | N#Cc1cc(Cl)cc(Oc2c(C(F)(F)F)ncn(CC3=CC(=O)C(=O)N=N3)c2=O)c1 |
| InChI | InChI=1S/C17H7ClF3N5O4/c18-9-1-8(5-22)2-11(3-9)30-13-14(17(19,20)21)23-7-26(16(13)29)6-10-4-12(27)15(28)25-24-10/h1-4,7H,6H2 |
| InChIKey | FRLBKPOULXJIIN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 126.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.72 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|