C26H30FN5O9 — CID 135121381
(2S)-2-[[(1S)-1-carboxy-5-[N-[2-[(6-fluoropyridine-3-carbonyl)amino]ethyl]anilino]-5-oxopentyl]carbamoylamino]pentanedioic acid (PubChem CID 135121381) has the molecular formula C26H30FN5O9 and a molecular weight of 575.55 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-5-[N-[2-[(6-fluoropyridine-3-carbonyl)amino]ethyl]anilino]-5-oxopentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-5-[N-[2-[(6-fluoropyridine-3-carbonyl)amino]ethyl]anilino]-5-oxopentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 135121381 |
| Molecular Formula | C26H30FN5O9 |
| Molecular Weight | 575.55 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-5-[N-[2-[(6-fluoropyridine-3-carbonyl)amino]ethyl]anilino]-5-oxopentyl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)N[C@@H](CCCC(=O)N(CCNC(=O)c1ccc(F)nc1)c1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C26H30FN5O9/c27-20-11-9-16(15-29-20)23(36)28-13-14-32(17-5-2-1-3-6-17)21(33)8-4-7-18(24(37)38)30-26(41)31-19(25(39)40)10-12-22(34)35/h1-3,5-6,9,11,15,18-19H,4,7-8,10,12-14H2,(H,28,36)(H,34,35)(H,37,38)(H,39,40)(H2,30,31,41)/t18-,19-/m0/s1 |
| InChIKey | AFDHXMJDHQVEHD-OALUTQOASA-N |
| XLogP | 1.22 |
| TPSA | 215.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.55 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|