About scandium(3+);bis(trifluoromethanesulfonate)
scandium(3+);bis(trifluoromethanesulfonate) (PubChem CID 135121751) has the molecular formula C2F6O6S2Sc+
and a molecular weight of 343.09 g/mol. Its IUPAC name is scandium(3+);bis(trifluoromethanesulfonate).
Molecular Properties
| Compound Name | scandium(3+);bis(trifluoromethanesulfonate) |
| PubChem CID | 135121751 |
| Molecular Formula | C2F6O6S2Sc+ |
| Molecular Weight | 343.09 g/mol |
| Exact Mass | 342.86 |
| IUPAC Name | scandium(3+);bis(trifluoromethanesulfonate) |
| SMILES | O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.[Sc+3] |
| InChI | InChI=1S/2CHF3O3S.Sc/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);/q;;+3/p-2 |
| InChIKey | YQSSDTQQZQLGHU-UHFFFAOYSA-L |
| XLogP | 0.10 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.09 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze scandium(3+);bis(trifluoromethanesulfonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of scandium(3+);bis(trifluoromethanesulfonate)?
The IUPAC name of scandium(3+);bis(trifluoromethanesulfonate) (CID 135121751) is scandium(3+);bis(trifluoromethanesulfonate).
What is the SMILES notation for scandium(3+);bis(trifluoromethanesulfonate)?
The canonical SMILES for scandium(3+);bis(trifluoromethanesulfonate) is O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.[Sc+3].
What is the InChIKey of scandium(3+);bis(trifluoromethanesulfonate)?
The InChIKey is YQSSDTQQZQLGHU-UHFFFAOYSA-L. The full InChI is InChI=1S/2CHF3O3S.Sc/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);/q;;+3/p-2.
What are the key properties of scandium(3+);bis(trifluoromethanesulfonate)?
scandium(3+);bis(trifluoromethanesulfonate) has a molecular weight of 343.09 g/mol, XLogP of 0.10, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for scandium(3+);bis(trifluoromethanesulfonate) is sourced from PubChem (CID 135121751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).