C23H14ClN3O3 — CID 135122097
2-[2-[2-(4-chlorophenyl)benzimidazol-1-yl]-2-oxoethyl]isoindole-1,3-dione (PubChem CID 135122097) has the molecular formula C23H14ClN3O3 and a molecular weight of 415.84 g/mol. Its IUPAC name is 2-[2-[2-(4-chlorophenyl)benzimidazol-1-yl]-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-(4-chlorophenyl)benzimidazol-1-yl]-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 135122097 |
| Molecular Formula | C23H14ClN3O3 |
| Molecular Weight | 415.84 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 2-[2-[2-(4-chlorophenyl)benzimidazol-1-yl]-2-oxoethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC(=O)n1c(-c2ccc(Cl)cc2)nc2ccccc21 |
| InChI | InChI=1S/C23H14ClN3O3/c24-15-11-9-14(10-12-15)21-25-18-7-3-4-8-19(18)27(21)20(28)13-26-22(29)16-5-1-2-6-17(16)23(26)30/h1-12H,13H2 |
| InChIKey | GABKPHPPWVUMFU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.84 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|