About 5-[6-[3-[3-(trifluoromethoxy)phenyl]cyclopentyl]oxy-3-pyridinyl]-1,2-oxazol-3-one
5-[6-[3-[3-(trifluoromethoxy)phenyl]cyclopentyl]oxy-3-pyridinyl]-1,2-oxazol-3-one (PubChem CID 135122218) has the molecular formula C20H17F3N2O4
and a molecular weight of 406.36 g/mol. Its IUPAC name is 5-[6-[3-[3-(trifluoromethoxy)phenyl]cyclopentyl]oxy-3-pyridinyl]-1,2-oxazol-3-one.
Molecular Properties
| Compound Name | 5-[6-[3-[3-(trifluoromethoxy)phenyl]cyclopentyl]oxy-3-pyridinyl]-1,2-oxazol-3-one |
| PubChem CID | 135122218 |
| Molecular Formula | C20H17F3N2O4 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 5-[6-[3-[3-(trifluoromethoxy)phenyl]cyclopentyl]oxy-3-pyridinyl]-1,2-oxazol-3-one |
| SMILES | O=c1cc(-c2ccc(OC3CCC(c4cccc(OC(F)(F)F)c4)C3)nc2)o[nH]1 |
| InChI | InChI=1S/C20H17F3N2O4/c21-20(22,23)28-16-3-1-2-12(9-16)13-4-6-15(8-13)27-19-7-5-14(11-24-19)17-10-18(26)25-29-17/h1-3,5,7,9-11,13,15H,4,6,8H2,(H,25,26) |
| InChIKey | WHVXUOFNBGLJRF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[6-[3-[3-(trifluoromethoxy)phenyl]cyclopentyl]oxy-3-pyridinyl]-1,2-oxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[6-[3-[3-(trifluoromethoxy)phenyl]cyclopentyl]oxy-3-pyridinyl]-1,2-oxazol-3-one?
The IUPAC name of 5-[6-[3-[3-(trifluoromethoxy)phenyl]cyclopentyl]oxy-3-pyridinyl]-1,2-oxazol-3-one (CID 135122218) is 5-[6-[3-[3-(trifluoromethoxy)phenyl]cyclopentyl]oxy-3-pyridinyl]-1,2-oxazol-3-one.
What is the SMILES notation for 5-[6-[3-[3-(trifluoromethoxy)phenyl]cyclopentyl]oxy-3-pyridinyl]-1,2-oxazol-3-one?
The canonical SMILES for 5-[6-[3-[3-(trifluoromethoxy)phenyl]cyclopentyl]oxy-3-pyridinyl]-1,2-oxazol-3-one is O=c1cc(-c2ccc(OC3CCC(c4cccc(OC(F)(F)F)c4)C3)nc2)o[nH]1.
What is the InChIKey of 5-[6-[3-[3-(trifluoromethoxy)phenyl]cyclopentyl]oxy-3-pyridinyl]-1,2-oxazol-3-one?
The InChIKey is WHVXUOFNBGLJRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F3N2O4/c21-20(22,23)28-16-3-1-2-12(9-16)13-4-6-15(8-13)27-19-7-5-14(11-24-19)17-10-18(26)25-29-17/h1-3,5,7,9-11,13,15H,4,6,8H2,(H,25,26).
What are the key properties of 5-[6-[3-[3-(trifluoromethoxy)phenyl]cyclopentyl]oxy-3-pyridinyl]-1,2-oxazol-3-one?
5-[6-[3-[3-(trifluoromethoxy)phenyl]cyclopentyl]oxy-3-pyridinyl]-1,2-oxazol-3-one has a molecular weight of 406.36 g/mol, XLogP of 4.64, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[6-[3-[3-(trifluoromethoxy)phenyl]cyclopentyl]oxy-3-pyridinyl]-1,2-oxazol-3-one is sourced from PubChem (CID 135122218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).