C11H16ClN3O — CID 135122360
5-chloro-2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1H-pyrimidin-6-one (PubChem CID 135122360) has the molecular formula C11H16ClN3O and a molecular weight of 241.72 g/mol. Its IUPAC name is 5-chloro-2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135122360 |
| Molecular Formula | C11H16ClN3O |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 5-chloro-2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1H-pyrimidin-6-one |
| SMILES | C[C@@H]1C[C@H](C)CN(c2ncc(Cl)c(=O)[nH]2)C1 |
| InChI | InChI=1S/C11H16ClN3O/c1-7-3-8(2)6-15(5-7)11-13-4-9(12)10(16)14-11/h4,7-8H,3,5-6H2,1-2H3,(H,13,14,16)/t7-,8+ |
| InChIKey | FJUMXKTZIZWYOT-OCAPTIKFSA-N |
| XLogP | 1.91 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |