C9H13NO3 — CID 135122446
butyl 2-methyl-1,3-oxazole-5-carboxylate (PubChem CID 135122446) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is butyl 2-methyl-1,3-oxazole-5-carboxylate.
| Compound Name | butyl 2-methyl-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 135122446 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | butyl 2-methyl-1,3-oxazole-5-carboxylate |
| SMILES | CCCCOC(=O)c1cnc(C)o1 |
| InChI | InChI=1S/C9H13NO3/c1-3-4-5-12-9(11)8-6-10-7(2)13-8/h6H,3-5H2,1-2H3 |
| InChIKey | ZDJJFEOFJZZIJJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|