C30H36F3N5O5 — CID 135123136
(2,2,2-trifluoroacetyl) (3R)-3-[3-[[(2R)-2-ethyl-7-methyl-3,5-dihydro-2H-pyrido[2,3-f][1,4]oxazepin-4-yl]methyl]-4-methylphenyl]-2,2-dimethyl-3-[(1-methyltriazol-4-yl)methoxy]propanoate (PubChem CID 135123136) has the molecular formula C30H36F3N5O5 and a molecular weight of 603.64 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (3R)-3-[3-[[(2R)-2-ethyl-7-methyl-3,5-dihydro-2H-pyrido[2,3-f][1,4]oxazepin-4-yl]methyl]-4-methylphenyl]-2,2-dimethyl-3-[(1-methyltriazol-4-yl)methoxy]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) (3R)-3-[3-[[(2R)-2-ethyl-7-methyl-3,5-dihydro-2H-pyrido[2,3-f][1,4]oxazepin-4-yl]methyl]-4-methylphenyl]-2,2-dimethyl-3-[(1-methyltriazol-4-yl)methoxy]propanoate |
|---|---|
| PubChem CID | 135123136 |
| Molecular Formula | C30H36F3N5O5 |
| Molecular Weight | 603.64 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (3R)-3-[3-[[(2R)-2-ethyl-7-methyl-3,5-dihydro-2H-pyrido[2,3-f][1,4]oxazepin-4-yl]methyl]-4-methylphenyl]-2,2-dimethyl-3-[(1-methyltriazol-4-yl)methoxy]propanoate |
| SMILES | CC[C@@H]1CN(Cc2cc([C@@H](OCc3cn(C)nn3)C(C)(C)C(=O)OC(=O)C(F)(F)F)ccc2C)Cc2nc(C)ccc2O1 |
| InChI | InChI=1S/C30H36F3N5O5/c1-7-23-15-38(16-24-25(42-23)11-9-19(3)34-24)13-21-12-20(10-8-18(21)2)26(41-17-22-14-37(6)36-35-22)29(4,5)27(39)43-28(40)30(31,32)33/h8-12,14,23,26H,7,13,15-17H2,1-6H3/t23-,26-/m1/s1 |
| InChIKey | XERNTMHDWGIEGO-ZEQKJWHPSA-N |
| XLogP | 4.92 |
| TPSA | 108.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|