C28H34F2N4O6S — CID 135123432
ethyl 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-[(1-ethyltriazol-4-yl)methoxy]-2,2-difluoropropanoate (PubChem CID 135123432) has the molecular formula C28H34F2N4O6S and a molecular weight of 592.67 g/mol. Its IUPAC name is ethyl 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-[(1-ethyltriazol-4-yl)methoxy]-2,2-difluoropropanoate.
| Compound Name | ethyl 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-[(1-ethyltriazol-4-yl)methoxy]-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 135123432 |
| Molecular Formula | C28H34F2N4O6S |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | ethyl 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-[(1-ethyltriazol-4-yl)methoxy]-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)C(OCc1cn(CC)nn1)c1ccc(C)c(CN2C[C@@H](CC)Oc3ccccc3S2(=O)=O)c1 |
| InChI | InChI=1S/C28H34F2N4O6S/c1-5-23-17-34(41(36,37)25-11-9-8-10-24(25)40-23)15-21-14-20(13-12-19(21)4)26(28(29,30)27(35)38-7-3)39-18-22-16-33(6-2)32-31-22/h8-14,16,23,26H,5-7,15,17-18H2,1-4H3/t23-,26?/m1/s1 |
| InChIKey | NMXWSWCMXSAPNY-GEPVFLLWSA-N |
| XLogP | 4.42 |
| TPSA | 112.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |