C26H30F2N4O6S — CID 135123497
3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-[(1-ethyltriazol-4-yl)methoxy]-2,2-difluoropropanoic acid (PubChem CID 135123497) has the molecular formula C26H30F2N4O6S and a molecular weight of 564.61 g/mol. Its IUPAC name is 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-[(1-ethyltriazol-4-yl)methoxy]-2,2-difluoropropanoic acid.
| Compound Name | 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-[(1-ethyltriazol-4-yl)methoxy]-2,2-difluoropropanoic acid |
|---|---|
| PubChem CID | 135123497 |
| Molecular Formula | C26H30F2N4O6S |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-[(1-ethyltriazol-4-yl)methoxy]-2,2-difluoropropanoic acid |
| SMILES | CC[C@@H]1CN(Cc2cc(C(OCc3cn(CC)nn3)C(F)(F)C(=O)O)ccc2C)S(=O)(=O)c2ccccc2O1 |
| InChI | InChI=1S/C26H30F2N4O6S/c1-4-21-15-32(39(35,36)23-9-7-6-8-22(23)38-21)13-19-12-18(11-10-17(19)3)24(26(27,28)25(33)34)37-16-20-14-31(5-2)30-29-20/h6-12,14,21,24H,4-5,13,15-16H2,1-3H3,(H,33,34)/t21-,24?/m1/s1 |
| InChIKey | PZDGQMSXHDLWOS-CILPGNKCSA-N |
| XLogP | 3.95 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |