C18H20N6 — CID 135123549
2-N,4-N-bis(4-aminophenyl)benzene-1,2,4,5-tetramine (PubChem CID 135123549) has the molecular formula C18H20N6 and a molecular weight of 320.40 g/mol. Its IUPAC name is 2-N,4-N-bis(4-aminophenyl)benzene-1,2,4,5-tetramine.
| Compound Name | 2-N,4-N-bis(4-aminophenyl)benzene-1,2,4,5-tetramine |
|---|---|
| PubChem CID | 135123549 |
| Molecular Formula | C18H20N6 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-N,4-N-bis(4-aminophenyl)benzene-1,2,4,5-tetramine |
| SMILES | Nc1ccc(Nc2cc(Nc3ccc(N)cc3)c(N)cc2N)cc1 |
| InChI | InChI=1S/C18H20N6/c19-11-1-5-13(6-2-11)23-17-10-18(16(22)9-15(17)21)24-14-7-3-12(20)4-8-14/h1-10,23-24H,19-22H2 |
| InChIKey | IWLHINLEIRIXLZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 128.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|