C21H17F5N4O2 — CID 135124643
6-[(Z)-2-[3-[(4R,5R)-2-amino-4-methyl-5-(2,2,2-trifluoroethoxy)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-fluoroethenyl]pyridine-3-carbonitrile (PubChem CID 135124643) has the molecular formula C21H17F5N4O2 and a molecular weight of 452.38 g/mol. Its IUPAC name is 6-[(Z)-2-[3-[(4R,5R)-2-amino-4-methyl-5-(2,2,2-trifluoroethoxy)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-fluoroethenyl]pyridine-3-carbonitrile.
| Compound Name | 6-[(Z)-2-[3-[(4R,5R)-2-amino-4-methyl-5-(2,2,2-trifluoroethoxy)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-fluoroethenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135124643 |
| Molecular Formula | C21H17F5N4O2 |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 6-[(Z)-2-[3-[(4R,5R)-2-amino-4-methyl-5-(2,2,2-trifluoroethoxy)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-fluoroethenyl]pyridine-3-carbonitrile |
| SMILES | C[C@]1(c2cc(/C=C(\F)c3ccc(C#N)cn3)ccc2F)N=C(N)OC[C@@H]1OCC(F)(F)F |
| InChI | InChI=1S/C21H17F5N4O2/c1-20(18(10-31-19(28)30-20)32-11-21(24,25)26)14-6-12(2-4-15(14)22)7-16(23)17-5-3-13(8-27)9-29-17/h2-7,9,18H,10-11H2,1H3,(H2,28,30)/b16-7-/t18-,20+/m0/s1 |
| InChIKey | AEKYEHPSMXADSM-AWVLJADFSA-N |
| XLogP | 4.07 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |