C19H15ClF6N4O2S — CID 135125772
(5R)-5-[5-[(Z)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-fluoroethenyl]-2,3-difluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 135125772) has the molecular formula C19H15ClF6N4O2S and a molecular weight of 512.86 g/mol. Its IUPAC name is (5R)-5-[5-[(Z)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-fluoroethenyl]-2,3-difluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5R)-5-[5-[(Z)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-fluoroethenyl]-2,3-difluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 135125772 |
| Molecular Formula | C19H15ClF6N4O2S |
| Molecular Weight | 512.86 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | (5R)-5-[5-[(Z)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-fluoroethenyl]-2,3-difluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1C(N)=N[C@](C)(c2cc(/C=C(\F)c3ncc(C(F)(F)F)cc3Cl)cc(F)c2F)CS1(=O)=O |
| InChI | InChI=1S/C19H15ClF6N4O2S/c1-18(8-33(31,32)30(2)17(27)29-18)11-3-9(4-13(21)15(11)23)5-14(22)16-12(20)6-10(7-28-16)19(24,25)26/h3-7H,8H2,1-2H3,(H2,27,29)/b14-5-/t18-/m0/s1 |
| InChIKey | XTPKUGBRVKAUSC-BLCJYSFRSA-N |
| XLogP | 4.30 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.86 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |