C22H20F3N7O3S — CID 135125801
(5R)-5-[2,3-difluoro-5-[(Z)-2-fluoro-2-[5-(pyrimidin-2-ylmethoxy)pyrazin-2-yl]ethenyl]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 135125801) has the molecular formula C22H20F3N7O3S and a molecular weight of 519.51 g/mol. Its IUPAC name is (5R)-5-[2,3-difluoro-5-[(Z)-2-fluoro-2-[5-(pyrimidin-2-ylmethoxy)pyrazin-2-yl]ethenyl]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5R)-5-[2,3-difluoro-5-[(Z)-2-fluoro-2-[5-(pyrimidin-2-ylmethoxy)pyrazin-2-yl]ethenyl]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 135125801 |
| Molecular Formula | C22H20F3N7O3S |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | (5R)-5-[2,3-difluoro-5-[(Z)-2-fluoro-2-[5-(pyrimidin-2-ylmethoxy)pyrazin-2-yl]ethenyl]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1C(N)=N[C@](C)(c2cc(/C=C(\F)c3cnc(OCc4ncccn4)cn3)cc(F)c2F)CS1(=O)=O |
| InChI | InChI=1S/C22H20F3N7O3S/c1-22(12-36(33,34)32(2)21(26)31-22)14-6-13(8-16(24)20(14)25)7-15(23)17-9-30-19(10-29-17)35-11-18-27-4-3-5-28-18/h3-10H,11-12H2,1-2H3,(H2,26,31)/b15-7-/t22-/m0/s1 |
| InChIKey | FFDDVJXLKUZNQX-AELLWPAVSA-N |
| XLogP | 2.40 |
| TPSA | 136.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |