C19H24F3N3O5S — CID 135125855
[5-[2,3-difluoro-5-[2-fluoro-2-(oxan-4-yl)ethenyl]phenyl]-1,1-dihydroxy-2,5-dimethyl-6H-1,2,4-thiadiazin-3-yl]carbamic acid (PubChem CID 135125855) has the molecular formula C19H24F3N3O5S and a molecular weight of 463.48 g/mol. Its IUPAC name is [5-[2,3-difluoro-5-[2-fluoro-2-(oxan-4-yl)ethenyl]phenyl]-1,1-dihydroxy-2,5-dimethyl-6H-1,2,4-thiadiazin-3-yl]carbamic acid.
| Compound Name | [5-[2,3-difluoro-5-[2-fluoro-2-(oxan-4-yl)ethenyl]phenyl]-1,1-dihydroxy-2,5-dimethyl-6H-1,2,4-thiadiazin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 135125855 |
| Molecular Formula | C19H24F3N3O5S |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | [5-[2,3-difluoro-5-[2-fluoro-2-(oxan-4-yl)ethenyl]phenyl]-1,1-dihydroxy-2,5-dimethyl-6H-1,2,4-thiadiazin-3-yl]carbamic acid |
| SMILES | CN1C(NC(=O)O)=NC(C)(c2cc(C=C(F)C3CCOCC3)cc(F)c2F)CS1(O)O |
| InChI | InChI=1S/C19H24F3N3O5S/c1-19(10-31(28,29)25(2)17(24-19)23-18(26)27)13-7-11(9-15(21)16(13)22)8-14(20)12-3-5-30-6-4-12/h7-9,12,28-29H,3-6,10H2,1-2H3,(H,23,24)(H,26,27) |
| InChIKey | BGGIDFRYYOHVSK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |