C21H22ClFN2O2S — CID 135125898
(3R)-3-[5-[(E)-2-(4-chlorophenyl)ethenyl]-2-fluorophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 135125898) has the molecular formula C21H22ClFN2O2S and a molecular weight of 420.94 g/mol. Its IUPAC name is (3R)-3-[5-[(E)-2-(4-chlorophenyl)ethenyl]-2-fluorophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3R)-3-[5-[(E)-2-(4-chlorophenyl)ethenyl]-2-fluorophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 135125898 |
| Molecular Formula | C21H22ClFN2O2S |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | (3R)-3-[5-[(E)-2-(4-chlorophenyl)ethenyl]-2-fluorophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(/C=C/c3ccc(Cl)cc3)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C21H22ClFN2O2S/c1-20(2)19(24)25-21(3,13-28(20,26)27)17-12-15(8-11-18(17)23)5-4-14-6-9-16(22)10-7-14/h4-12H,13H2,1-3H3,(H2,24,25)/b5-4+/t21-/m0/s1 |
| InChIKey | PCOXDXAAPSNFFJ-FNEOHHHZSA-N |
| XLogP | 4.43 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|