C21H21F2N5O2S — CID 135125902
6-[(Z)-2-[3-[(5R)-3-amino-2,5,6,6-tetramethyl-1,1-dioxo-1,2,4-thiadiazin-5-yl]-4-fluorophenyl]-1-fluoroethenyl]pyridine-3-carbonitrile (PubChem CID 135125902) has the molecular formula C21H21F2N5O2S and a molecular weight of 445.50 g/mol. Its IUPAC name is 6-[(Z)-2-[3-[(5R)-3-amino-2,5,6,6-tetramethyl-1,1-dioxo-1,2,4-thiadiazin-5-yl]-4-fluorophenyl]-1-fluoroethenyl]pyridine-3-carbonitrile.
| Compound Name | 6-[(Z)-2-[3-[(5R)-3-amino-2,5,6,6-tetramethyl-1,1-dioxo-1,2,4-thiadiazin-5-yl]-4-fluorophenyl]-1-fluoroethenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135125902 |
| Molecular Formula | C21H21F2N5O2S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 6-[(Z)-2-[3-[(5R)-3-amino-2,5,6,6-tetramethyl-1,1-dioxo-1,2,4-thiadiazin-5-yl]-4-fluorophenyl]-1-fluoroethenyl]pyridine-3-carbonitrile |
| SMILES | CN1C(N)=N[C@](C)(c2cc(/C=C(\F)c3ccc(C#N)cn3)ccc2F)C(C)(C)S1(=O)=O |
| InChI | InChI=1S/C21H21F2N5O2S/c1-20(2)21(3,27-19(25)28(4)31(20,29)30)15-9-13(5-7-16(15)22)10-17(23)18-8-6-14(11-24)12-26-18/h5-10,12H,1-4H3,(H2,25,27)/b17-10-/t21-/m1/s1 |
| InChIKey | QEYADQLWMCYXIK-SYEXPRJDSA-N |
| XLogP | 3.14 |
| TPSA | 112.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |