C22H24N8O — CID 135126075
2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-(1H-imidazol-2-ylmethyl)acetamide (PubChem CID 135126075) has the molecular formula C22H24N8O and a molecular weight of 416.49 g/mol. Its IUPAC name is 2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-(1H-imidazol-2-ylmethyl)acetamide.
| Compound Name | 2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-(1H-imidazol-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 135126075 |
| Molecular Formula | C22H24N8O |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]-N-(1H-imidazol-2-ylmethyl)acetamide |
| SMILES | N#CCC1CCC(n2c(CC(=O)NCc3ncc[nH]3)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C22H24N8O/c23-7-5-14-1-3-15(4-2-14)30-19(11-20(31)27-13-18-24-9-10-25-18)29-17-12-28-22-16(21(17)30)6-8-26-22/h6,8-10,12,14-15H,1-5,11,13H2,(H,24,25)(H,26,28)(H,27,31) |
| InChIKey | CBVPDJRQJISLMN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 128.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |