About 6-(1H-indol-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxamide
6-(1H-indol-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxamide (PubChem CID 135126324) has the molecular formula C22H23N3O2
and a molecular weight of 361.45 g/mol. Its IUPAC name is 6-(1H-indol-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxamide.
Molecular Properties
| Compound Name | 6-(1H-indol-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxamide |
| PubChem CID | 135126324 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 6-(1H-indol-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxamide |
| SMILES | NC(=O)N1CCC2(CCc3cc(-c4cc5ccccc5[nH]4)ccc3O2)CC1 |
| InChI | InChI=1S/C22H23N3O2/c23-21(26)25-11-9-22(10-12-25)8-7-17-13-16(5-6-20(17)27-22)19-14-15-3-1-2-4-18(15)24-19/h1-6,13-14,24H,7-12H2,(H2,23,26) |
| InChIKey | QTLDWTOGCZULFP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(1H-indol-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1H-indol-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxamide?
The IUPAC name of 6-(1H-indol-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxamide (CID 135126324) is 6-(1H-indol-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxamide.
What is the SMILES notation for 6-(1H-indol-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxamide?
The canonical SMILES for 6-(1H-indol-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxamide is NC(=O)N1CCC2(CCc3cc(-c4cc5ccccc5[nH]4)ccc3O2)CC1.
What is the InChIKey of 6-(1H-indol-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxamide?
The InChIKey is QTLDWTOGCZULFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O2/c23-21(26)25-11-9-22(10-12-25)8-7-17-13-16(5-6-20(17)27-22)19-14-15-3-1-2-4-18(15)24-19/h1-6,13-14,24H,7-12H2,(H2,23,26).
What are the key properties of 6-(1H-indol-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxamide?
6-(1H-indol-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxamide has a molecular weight of 361.45 g/mol, XLogP of 4.07, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1H-indol-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxamide is sourced from PubChem (CID 135126324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).