C21H19F3N4O2S — CID 135126388
6-[(Z)-2-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-1-fluoroethenyl]pyridine-3-carbonitrile (PubChem CID 135126388) has the molecular formula C21H19F3N4O2S and a molecular weight of 448.47 g/mol. Its IUPAC name is 6-[(Z)-2-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-1-fluoroethenyl]pyridine-3-carbonitrile.
| Compound Name | 6-[(Z)-2-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-1-fluoroethenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135126388 |
| Molecular Formula | C21H19F3N4O2S |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 6-[(Z)-2-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-1-fluoroethenyl]pyridine-3-carbonitrile |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(/C=C(\F)c3ccc(C#N)cn3)cc(F)c2F)CS1(=O)=O |
| InChI | InChI=1S/C21H19F3N4O2S/c1-20(2)19(26)28-21(3,11-31(20,29)30)14-6-13(8-16(23)18(14)24)7-15(22)17-5-4-12(9-25)10-27-17/h4-8,10H,11H2,1-3H3,(H2,26,28)/b15-7-/t21-/m0/s1 |
| InChIKey | BQVXXVMHASLYMT-HVMJPGQCSA-N |
| XLogP | 3.48 |
| TPSA | 109.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |