C19H16F3N5O2S — CID 135126403
6-[(Z)-2-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4,5-difluorophenyl]-1-fluoroethenyl]pyridine-3-carbonitrile (PubChem CID 135126403) has the molecular formula C19H16F3N5O2S and a molecular weight of 435.43 g/mol. Its IUPAC name is 6-[(Z)-2-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4,5-difluorophenyl]-1-fluoroethenyl]pyridine-3-carbonitrile.
| Compound Name | 6-[(Z)-2-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4,5-difluorophenyl]-1-fluoroethenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135126403 |
| Molecular Formula | C19H16F3N5O2S |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 6-[(Z)-2-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4,5-difluorophenyl]-1-fluoroethenyl]pyridine-3-carbonitrile |
| SMILES | CN1C(N)=N[C@](C)(c2cc(/C=C(\F)c3ccc(C#N)cn3)cc(F)c2F)CS1(=O)=O |
| InChI | InChI=1S/C19H16F3N5O2S/c1-19(10-30(28,29)27(2)18(24)26-19)13-5-12(7-15(21)17(13)22)6-14(20)16-4-3-11(8-23)9-25-16/h3-7,9H,10H2,1-2H3,(H2,24,26)/b14-6-/t19-/m0/s1 |
| InChIKey | HDKKEPJHRYPLPT-COXIKBTRSA-N |
| XLogP | 2.50 |
| TPSA | 112.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |