C10H14O2 — CID 135127515
(6R)-6-[(2E)-penta-2,4-dienyl]oxan-3-one (PubChem CID 135127515) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (6R)-6-[(2E)-penta-2,4-dienyl]oxan-3-one.
| Compound Name | (6R)-6-[(2E)-penta-2,4-dienyl]oxan-3-one |
|---|---|
| PubChem CID | 135127515 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (6R)-6-[(2E)-penta-2,4-dienyl]oxan-3-one |
| SMILES | C=C/C=C/C[C@H]1CCC(=O)CO1 |
| InChI | InChI=1S/C10H14O2/c1-2-3-4-5-10-7-6-9(11)8-12-10/h2-4,10H,1,5-8H2/b4-3+/t10-/m0/s1 |
| InChIKey | PVYVXOBWHYEXCP-FSIBCCDJSA-N |
| XLogP | 1.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|