About (3R,6R)-6-[(2E)-penta-2,4-dienyl]oxan-3-amine
(3R,6R)-6-[(2E)-penta-2,4-dienyl]oxan-3-amine (PubChem CID 135127542) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is (3R,6R)-6-[(2E)-penta-2,4-dienyl]oxan-3-amine.
Molecular Properties
| Compound Name | (3R,6R)-6-[(2E)-penta-2,4-dienyl]oxan-3-amine |
| PubChem CID | 135127542 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (3R,6R)-6-[(2E)-penta-2,4-dienyl]oxan-3-amine |
| SMILES | C=C/C=C/C[C@H]1CC[C@@H](N)CO1 |
| InChI | InChI=1S/C10H17NO/c1-2-3-4-5-10-7-6-9(11)8-12-10/h2-4,9-10H,1,5-8,11H2/b4-3+/t9-,10+/m1/s1 |
| InChIKey | DHNZCFCAEBJYJN-OKWQPMOJSA-N |
| XLogP | 1.62 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3R,6R)-6-[(2E)-penta-2,4-dienyl]oxan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,6R)-6-[(2E)-penta-2,4-dienyl]oxan-3-amine?
The IUPAC name of (3R,6R)-6-[(2E)-penta-2,4-dienyl]oxan-3-amine (CID 135127542) is (3R,6R)-6-[(2E)-penta-2,4-dienyl]oxan-3-amine.
What is the SMILES notation for (3R,6R)-6-[(2E)-penta-2,4-dienyl]oxan-3-amine?
The canonical SMILES for (3R,6R)-6-[(2E)-penta-2,4-dienyl]oxan-3-amine is C=C/C=C/C[C@H]1CC[C@@H](N)CO1.
What is the InChIKey of (3R,6R)-6-[(2E)-penta-2,4-dienyl]oxan-3-amine?
The InChIKey is DHNZCFCAEBJYJN-OKWQPMOJSA-N. The full InChI is InChI=1S/C10H17NO/c1-2-3-4-5-10-7-6-9(11)8-12-10/h2-4,9-10H,1,5-8,11H2/b4-3+/t9-,10+/m1/s1.
What are the key properties of (3R,6R)-6-[(2E)-penta-2,4-dienyl]oxan-3-amine?
(3R,6R)-6-[(2E)-penta-2,4-dienyl]oxan-3-amine has a molecular weight of 167.25 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,6R)-6-[(2E)-penta-2,4-dienyl]oxan-3-amine is sourced from PubChem (CID 135127542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).