C26H34FN — CID 135128083
3-cyclohex-3-en-1-yl-7-(4-fluoro-2-methylcyclohexa-2,4-dien-1-yl)-N,8-dimethyl-4-methylidene-2,3,6,7-tetrahydro-1H-naphthalen-1-amine (PubChem CID 135128083) has the molecular formula C26H34FN and a molecular weight of 379.56 g/mol. Its IUPAC name is 3-cyclohex-3-en-1-yl-7-(4-fluoro-2-methylcyclohexa-2,4-dien-1-yl)-N,8-dimethyl-4-methylidene-2,3,6,7-tetrahydro-1H-naphthalen-1-amine.
| Compound Name | 3-cyclohex-3-en-1-yl-7-(4-fluoro-2-methylcyclohexa-2,4-dien-1-yl)-N,8-dimethyl-4-methylidene-2,3,6,7-tetrahydro-1H-naphthalen-1-amine |
|---|---|
| PubChem CID | 135128083 |
| Molecular Formula | C26H34FN |
| Molecular Weight | 379.56 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | 3-cyclohex-3-en-1-yl-7-(4-fluoro-2-methylcyclohexa-2,4-dien-1-yl)-N,8-dimethyl-4-methylidene-2,3,6,7-tetrahydro-1H-naphthalen-1-amine |
| SMILES | C=C1C2=CCC(C3CC=C(F)C=C3C)C(C)=C2C(NC)CC1C1CC=CCC1 |
| InChI | InChI=1S/C26H34FN/c1-16-14-20(27)10-11-21(16)22-12-13-23-17(2)24(19-8-6-5-7-9-19)15-25(28-4)26(23)18(22)3/h5-6,10,13-14,19,21-22,24-25,28H,2,7-9,11-12,15H2,1,3-4H3 |
| InChIKey | HEHDGOFECRVNTI-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.56 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|