C20H21F3N4 — CID 135128128
N-methyl-2-(1,2,3,4-tetrahydropyridin-3-yl)-7-(3,4,6-trifluorocyclohexa-1,5-dien-1-yl)-6,7-dihydroquinazolin-4-amine (PubChem CID 135128128) has the molecular formula C20H21F3N4 and a molecular weight of 374.41 g/mol. Its IUPAC name is N-methyl-2-(1,2,3,4-tetrahydropyridin-3-yl)-7-(3,4,6-trifluorocyclohexa-1,5-dien-1-yl)-6,7-dihydroquinazolin-4-amine.
| Compound Name | N-methyl-2-(1,2,3,4-tetrahydropyridin-3-yl)-7-(3,4,6-trifluorocyclohexa-1,5-dien-1-yl)-6,7-dihydroquinazolin-4-amine |
|---|---|
| PubChem CID | 135128128 |
| Molecular Formula | C20H21F3N4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N-methyl-2-(1,2,3,4-tetrahydropyridin-3-yl)-7-(3,4,6-trifluorocyclohexa-1,5-dien-1-yl)-6,7-dihydroquinazolin-4-amine |
| SMILES | CNc1nc(C2CC=CNC2)nc2c1=CCC(C1=CC(F)C(F)C=C1F)C=2 |
| InChI | InChI=1S/C20H21F3N4/c1-24-20-13-5-4-11(14-8-16(22)17(23)9-15(14)21)7-18(13)26-19(27-20)12-3-2-6-25-10-12/h2,5-9,11-12,16-17,25H,3-4,10H2,1H3,(H,24,26,27) |
| InChIKey | UVRODURKTTWCOE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |