About N-[4-fluoro-7-[(Z)-prop-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine
N-[4-fluoro-7-[(Z)-prop-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine (PubChem CID 135128525) has the molecular formula C11H12FN
and a molecular weight of 177.22 g/mol. Its IUPAC name is N-[4-fluoro-7-[(Z)-prop-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine.
Molecular Properties
| Compound Name | N-[4-fluoro-7-[(Z)-prop-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine |
| PubChem CID | 135128525 |
| Molecular Formula | C11H12FN |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | N-[4-fluoro-7-[(Z)-prop-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine |
| SMILES | C=NC1=CC=C(F)CC=C1/C=C\C |
| InChI | InChI=1S/C11H12FN/c1-3-4-9-5-6-10(12)7-8-11(9)13-2/h3-5,7-8H,2,6H2,1H3/b4-3- |
| InChIKey | UQBHJKPDHYTHAW-ARJAWSKDSA-N |
| XLogP | 3.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-fluoro-7-[(Z)-prop-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-fluoro-7-[(Z)-prop-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine?
The IUPAC name of N-[4-fluoro-7-[(Z)-prop-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine (CID 135128525) is N-[4-fluoro-7-[(Z)-prop-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine.
What is the SMILES notation for N-[4-fluoro-7-[(Z)-prop-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine?
The canonical SMILES for N-[4-fluoro-7-[(Z)-prop-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine is C=NC1=CC=C(F)CC=C1/C=C\C.
What is the InChIKey of N-[4-fluoro-7-[(Z)-prop-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine?
The InChIKey is UQBHJKPDHYTHAW-ARJAWSKDSA-N. The full InChI is InChI=1S/C11H12FN/c1-3-4-9-5-6-10(12)7-8-11(9)13-2/h3-5,7-8H,2,6H2,1H3/b4-3-.
What are the key properties of N-[4-fluoro-7-[(Z)-prop-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine?
N-[4-fluoro-7-[(Z)-prop-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine has a molecular weight of 177.22 g/mol, XLogP of 3.33, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-fluoro-7-[(Z)-prop-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine is sourced from PubChem (CID 135128525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).