C10H10F10 — CID 135128627
(E,6R)-2,2,3,4,5,5,7,7,8,8-decafluoro-6-methylnon-3-ene (PubChem CID 135128627) has the molecular formula C10H10F10 and a molecular weight of 320.17 g/mol. Its IUPAC name is (E,6R)-2,2,3,4,5,5,7,7,8,8-decafluoro-6-methylnon-3-ene.
| Compound Name | (E,6R)-2,2,3,4,5,5,7,7,8,8-decafluoro-6-methylnon-3-ene |
|---|---|
| PubChem CID | 135128627 |
| Molecular Formula | C10H10F10 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (E,6R)-2,2,3,4,5,5,7,7,8,8-decafluoro-6-methylnon-3-ene |
| SMILES | C[C@H](C(F)(F)/C(F)=C(\F)C(C)(F)F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C10H10F10/c1-4(10(19,20)8(3,15)16)9(17,18)6(12)5(11)7(2,13)14/h4H,1-3H3/b6-5+/t4-/m1/s1 |
| InChIKey | ICJJHVRDWDMJPA-QAWSSWINSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|