About 3-methyl-2-octyl-4-oxo-8,8a-dihydroquinoline-1-carbonitrile
3-methyl-2-octyl-4-oxo-8,8a-dihydroquinoline-1-carbonitrile (PubChem CID 135128743) has the molecular formula C19H26N2O
and a molecular weight of 298.43 g/mol. Its IUPAC name is 3-methyl-2-octyl-4-oxo-8,8a-dihydroquinoline-1-carbonitrile.
Molecular Properties
| Compound Name | 3-methyl-2-octyl-4-oxo-8,8a-dihydroquinoline-1-carbonitrile |
| PubChem CID | 135128743 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 3-methyl-2-octyl-4-oxo-8,8a-dihydroquinoline-1-carbonitrile |
| SMILES | CCCCCCCCC1=C(C)C(=O)C2=CC=CCC2N1C#N |
| InChI | InChI=1S/C19H26N2O/c1-3-4-5-6-7-8-12-17-15(2)19(22)16-11-9-10-13-18(16)21(17)14-20/h9-11,18H,3-8,12-13H2,1-2H3 |
| InChIKey | CWSBJYRJZNHPII-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2-octyl-4-oxo-8,8a-dihydroquinoline-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-octyl-4-oxo-8,8a-dihydroquinoline-1-carbonitrile?
The IUPAC name of 3-methyl-2-octyl-4-oxo-8,8a-dihydroquinoline-1-carbonitrile (CID 135128743) is 3-methyl-2-octyl-4-oxo-8,8a-dihydroquinoline-1-carbonitrile.
What is the SMILES notation for 3-methyl-2-octyl-4-oxo-8,8a-dihydroquinoline-1-carbonitrile?
The canonical SMILES for 3-methyl-2-octyl-4-oxo-8,8a-dihydroquinoline-1-carbonitrile is CCCCCCCCC1=C(C)C(=O)C2=CC=CCC2N1C#N.
What is the InChIKey of 3-methyl-2-octyl-4-oxo-8,8a-dihydroquinoline-1-carbonitrile?
The InChIKey is CWSBJYRJZNHPII-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O/c1-3-4-5-6-7-8-12-17-15(2)19(22)16-11-9-10-13-18(16)21(17)14-20/h9-11,18H,3-8,12-13H2,1-2H3.
What are the key properties of 3-methyl-2-octyl-4-oxo-8,8a-dihydroquinoline-1-carbonitrile?
3-methyl-2-octyl-4-oxo-8,8a-dihydroquinoline-1-carbonitrile has a molecular weight of 298.43 g/mol, XLogP of 4.63, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-octyl-4-oxo-8,8a-dihydroquinoline-1-carbonitrile is sourced from PubChem (CID 135128743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).