About 1,2-dimethyl-4,5-dimethylideneimidazole
1,2-dimethyl-4,5-dimethylideneimidazole (PubChem CID 135128795) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 1,2-dimethyl-4,5-dimethylideneimidazole.
Molecular Properties
| Compound Name | 1,2-dimethyl-4,5-dimethylideneimidazole |
| PubChem CID | 135128795 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 1,2-dimethyl-4,5-dimethylideneimidazole |
| SMILES | C=c1nc(C)n(C)c1=C |
| InChI | InChI=1S/C7H10N2/c1-5-6(2)9(4)7(3)8-5/h1-2H2,3-4H3 |
| InChIKey | QKTXSDYIPYTAII-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dimethyl-4,5-dimethylideneimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-4,5-dimethylideneimidazole?
The IUPAC name of 1,2-dimethyl-4,5-dimethylideneimidazole (CID 135128795) is 1,2-dimethyl-4,5-dimethylideneimidazole.
What is the SMILES notation for 1,2-dimethyl-4,5-dimethylideneimidazole?
The canonical SMILES for 1,2-dimethyl-4,5-dimethylideneimidazole is C=c1nc(C)n(C)c1=C.
What is the InChIKey of 1,2-dimethyl-4,5-dimethylideneimidazole?
The InChIKey is QKTXSDYIPYTAII-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2/c1-5-6(2)9(4)7(3)8-5/h1-2H2,3-4H3.
What are the key properties of 1,2-dimethyl-4,5-dimethylideneimidazole?
1,2-dimethyl-4,5-dimethylideneimidazole has a molecular weight of 122.17 g/mol, XLogP of -0.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-4,5-dimethylideneimidazole is sourced from PubChem (CID 135128795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).