C19H23N9O — CID 135128852
1-[(1R)-3-[9-ethyl-6-[(1-methylpyrazol-4-yl)amino]purin-2-yl]-3,6-diazabicyclo[3.2.0]heptan-6-yl]prop-2-en-1-one (PubChem CID 135128852) has the molecular formula C19H23N9O and a molecular weight of 393.46 g/mol. Its IUPAC name is 1-[(1R)-3-[9-ethyl-6-[(1-methylpyrazol-4-yl)amino]purin-2-yl]-3,6-diazabicyclo[3.2.0]heptan-6-yl]prop-2-en-1-one.
| Compound Name | 1-[(1R)-3-[9-ethyl-6-[(1-methylpyrazol-4-yl)amino]purin-2-yl]-3,6-diazabicyclo[3.2.0]heptan-6-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 135128852 |
| Molecular Formula | C19H23N9O |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 1-[(1R)-3-[9-ethyl-6-[(1-methylpyrazol-4-yl)amino]purin-2-yl]-3,6-diazabicyclo[3.2.0]heptan-6-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H]2CN(c3nc(Nc4cnn(C)c4)c4ncn(CC)c4n3)CC21 |
| InChI | InChI=1S/C19H23N9O/c1-4-15(29)28-8-12-7-27(10-14(12)28)19-23-17(22-13-6-21-25(3)9-13)16-18(24-19)26(5-2)11-20-16/h4,6,9,11-12,14H,1,5,7-8,10H2,2-3H3,(H,22,23,24)/t12-,14?/m1/s1 |
| InChIKey | NNYWBIKIDLMZEU-PUODRLBUSA-N |
| XLogP | 1.16 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|