C16H24N2O — CID 135129031
(1R)-2-[[(3E,5E)-6-aminoocta-3,5,7-trienyl]amino]-1-cyclohexa-1,5-dien-1-ylethanol (PubChem CID 135129031) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is (1R)-2-[[(3E,5E)-6-aminoocta-3,5,7-trienyl]amino]-1-cyclohexa-1,5-dien-1-ylethanol.
| Compound Name | (1R)-2-[[(3E,5E)-6-aminoocta-3,5,7-trienyl]amino]-1-cyclohexa-1,5-dien-1-ylethanol |
|---|---|
| PubChem CID | 135129031 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | (1R)-2-[[(3E,5E)-6-aminoocta-3,5,7-trienyl]amino]-1-cyclohexa-1,5-dien-1-ylethanol |
| SMILES | C=C/C(N)=C\C=C\CCNC[C@H](O)C1=CCCC=C1 |
| InChI | InChI=1S/C16H24N2O/c1-2-15(17)11-7-4-8-12-18-13-16(19)14-9-5-3-6-10-14/h2,4-5,7,9-11,16,18-19H,1,3,6,8,12-13,17H2/b7-4+,15-11+/t16-/m0/s1 |
| InChIKey | KKJSCHXHGOKRSZ-ZIDPJXFSSA-N |
| XLogP | 2.19 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|