C7H9IN2 — CID 135129321
6-iodo-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine (PubChem CID 135129321) has the molecular formula C7H9IN2 and a molecular weight of 248.07 g/mol. Its IUPAC name is 6-iodo-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine.
| Compound Name | 6-iodo-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 135129321 |
| Molecular Formula | C7H9IN2 |
| Molecular Weight | 248.07 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | 6-iodo-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine |
| SMILES | Ic1ccc2n1CCNC2 |
| InChI | InChI=1S/C7H9IN2/c8-7-2-1-6-5-9-3-4-10(6)7/h1-2,9H,3-5H2 |
| InChIKey | OTJQKYCERFCLSL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.07 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|