C20H38N2 — CID 135129677
1-N-hexyl-3,3-dimethyl-4-methylidene-5-N-[(3Z)-penta-1,3-dien-2-yl]hexane-1,5-diamine (PubChem CID 135129677) has the molecular formula C20H38N2 and a molecular weight of 306.54 g/mol. Its IUPAC name is 1-N-hexyl-3,3-dimethyl-4-methylidene-5-N-[(3Z)-penta-1,3-dien-2-yl]hexane-1,5-diamine.
| Compound Name | 1-N-hexyl-3,3-dimethyl-4-methylidene-5-N-[(3Z)-penta-1,3-dien-2-yl]hexane-1,5-diamine |
|---|---|
| PubChem CID | 135129677 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | 1-N-hexyl-3,3-dimethyl-4-methylidene-5-N-[(3Z)-penta-1,3-dien-2-yl]hexane-1,5-diamine |
| SMILES | C=C(/C=C\C)NC(C)C(=C)C(C)(C)CCNCCCCCC |
| InChI | InChI=1S/C20H38N2/c1-8-10-11-12-15-21-16-14-20(6,7)18(4)19(5)22-17(3)13-9-2/h9,13,19,21-22H,3-4,8,10-12,14-16H2,1-2,5-7H3/b13-9- |
| InChIKey | CUURZWJFWYRNOM-LCYFTJDESA-N |
| XLogP | 5.20 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|