C15H23N3OS — CID 135129842
[(2Z,4Z,6Z)-3-[[2-[ethyl(methyl)amino]acetyl]amino]-4-methylocta-2,4,6-trien-2-yl] thiocyanate (PubChem CID 135129842) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is [(2Z,4Z,6Z)-3-[[2-[ethyl(methyl)amino]acetyl]amino]-4-methylocta-2,4,6-trien-2-yl] thiocyanate.
| Compound Name | [(2Z,4Z,6Z)-3-[[2-[ethyl(methyl)amino]acetyl]amino]-4-methylocta-2,4,6-trien-2-yl] thiocyanate |
|---|---|
| PubChem CID | 135129842 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | [(2Z,4Z,6Z)-3-[[2-[ethyl(methyl)amino]acetyl]amino]-4-methylocta-2,4,6-trien-2-yl] thiocyanate |
| SMILES | C/C=C\C=C(C)/C(NC(=O)CN(C)CC)=C(\C)SC#N |
| InChI | InChI=1S/C15H23N3OS/c1-6-8-9-12(3)15(13(4)20-11-16)17-14(19)10-18(5)7-2/h6,8-9H,7,10H2,1-5H3,(H,17,19)/b8-6-,12-9-,15-13- |
| InChIKey | CRSUBNKLSSRVDN-LAXNJWSQSA-N |
| XLogP | 3.02 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|