About N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(4-methylphenyl)-N-propylbut-3-en-2-amine
N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(4-methylphenyl)-N-propylbut-3-en-2-amine (PubChem CID 135130009) has the molecular formula C21H29N
and a molecular weight of 295.47 g/mol. Its IUPAC name is N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(4-methylphenyl)-N-propylbut-3-en-2-amine.
Molecular Properties
| Compound Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(4-methylphenyl)-N-propylbut-3-en-2-amine |
| PubChem CID | 135130009 |
| Molecular Formula | C21H29N |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(4-methylphenyl)-N-propylbut-3-en-2-amine |
| SMILES | C=C(c1ccc(C)cc1)C(C)N(CCC)CC1=CCCC=C1 |
| InChI | InChI=1S/C21H29N/c1-5-15-22(16-20-9-7-6-8-10-20)19(4)18(3)21-13-11-17(2)12-14-21/h7,9-14,19H,3,5-6,8,15-16H2,1-2,4H3 |
| InChIKey | PFVXOECZDHLGPM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(4-methylphenyl)-N-propylbut-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(4-methylphenyl)-N-propylbut-3-en-2-amine?
The IUPAC name of N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(4-methylphenyl)-N-propylbut-3-en-2-amine (CID 135130009) is N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(4-methylphenyl)-N-propylbut-3-en-2-amine.
What is the SMILES notation for N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(4-methylphenyl)-N-propylbut-3-en-2-amine?
The canonical SMILES for N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(4-methylphenyl)-N-propylbut-3-en-2-amine is C=C(c1ccc(C)cc1)C(C)N(CCC)CC1=CCCC=C1.
What is the InChIKey of N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(4-methylphenyl)-N-propylbut-3-en-2-amine?
The InChIKey is PFVXOECZDHLGPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29N/c1-5-15-22(16-20-9-7-6-8-10-20)19(4)18(3)21-13-11-17(2)12-14-21/h7,9-14,19H,3,5-6,8,15-16H2,1-2,4H3.
What are the key properties of N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(4-methylphenyl)-N-propylbut-3-en-2-amine?
N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(4-methylphenyl)-N-propylbut-3-en-2-amine has a molecular weight of 295.47 g/mol, XLogP of 5.39, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(4-methylphenyl)-N-propylbut-3-en-2-amine is sourced from PubChem (CID 135130009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).