About [4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]phenyl]-(5-methyl-2-pyridinyl)diazene
[4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]phenyl]-(5-methyl-2-pyridinyl)diazene (PubChem CID 135130274) has the molecular formula C21H15F2N3
and a molecular weight of 347.37 g/mol. Its IUPAC name is [4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]phenyl]-(5-methyl-2-pyridinyl)diazene.
Molecular Properties
| Compound Name | [4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]phenyl]-(5-methyl-2-pyridinyl)diazene |
| PubChem CID | 135130274 |
| Molecular Formula | C21H15F2N3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | [4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]phenyl]-(5-methyl-2-pyridinyl)diazene |
| SMILES | Cc1ccc(/N=N/c2ccc(C#Cc3c(F)cc(C)cc3F)cc2)nc1 |
| InChI | InChI=1S/C21H15F2N3/c1-14-3-10-21(24-13-14)26-25-17-7-4-16(5-8-17)6-9-18-19(22)11-15(2)12-20(18)23/h3-5,7-8,10-13H,1-2H3/b26-25+ |
| InChIKey | XKWVKKTYUGPZNE-OCEACIFDSA-N |
| XLogP | 5.79 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]phenyl]-(5-methyl-2-pyridinyl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]phenyl]-(5-methyl-2-pyridinyl)diazene?
The IUPAC name of [4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]phenyl]-(5-methyl-2-pyridinyl)diazene (CID 135130274) is [4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]phenyl]-(5-methyl-2-pyridinyl)diazene.
What is the SMILES notation for [4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]phenyl]-(5-methyl-2-pyridinyl)diazene?
The canonical SMILES for [4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]phenyl]-(5-methyl-2-pyridinyl)diazene is Cc1ccc(/N=N/c2ccc(C#Cc3c(F)cc(C)cc3F)cc2)nc1.
What is the InChIKey of [4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]phenyl]-(5-methyl-2-pyridinyl)diazene?
The InChIKey is XKWVKKTYUGPZNE-OCEACIFDSA-N. The full InChI is InChI=1S/C21H15F2N3/c1-14-3-10-21(24-13-14)26-25-17-7-4-16(5-8-17)6-9-18-19(22)11-15(2)12-20(18)23/h3-5,7-8,10-13H,1-2H3/b26-25+.
What are the key properties of [4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]phenyl]-(5-methyl-2-pyridinyl)diazene?
[4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]phenyl]-(5-methyl-2-pyridinyl)diazene has a molecular weight of 347.37 g/mol, XLogP of 5.79, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]phenyl]-(5-methyl-2-pyridinyl)diazene is sourced from PubChem (CID 135130274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).