C57H26F10N6 — CID 135130852
5-[4-[2,6-bis(2,3,4,5,6-pentafluorophenyl)pyrimidin-4-yl]-2,6-di(carbazol-9-yl)phenyl]pyrido[3,2-b]indole (PubChem CID 135130852) has the molecular formula C57H26F10N6 and a molecular weight of 984.86 g/mol. Its IUPAC name is 5-[4-[2,6-bis(2,3,4,5,6-pentafluorophenyl)pyrimidin-4-yl]-2,6-di(carbazol-9-yl)phenyl]pyrido[3,2-b]indole.
| Compound Name | 5-[4-[2,6-bis(2,3,4,5,6-pentafluorophenyl)pyrimidin-4-yl]-2,6-di(carbazol-9-yl)phenyl]pyrido[3,2-b]indole |
|---|---|
| PubChem CID | 135130852 |
| Molecular Formula | C57H26F10N6 |
| Molecular Weight | 984.86 g/mol |
| Exact Mass | 984.21 |
| IUPAC Name | 5-[4-[2,6-bis(2,3,4,5,6-pentafluorophenyl)pyrimidin-4-yl]-2,6-di(carbazol-9-yl)phenyl]pyrido[3,2-b]indole |
| SMILES | Fc1c(F)c(F)c(-c2cc(-c3cc(-n4c5ccccc5c5ccccc54)c(-n4c5ccccc5c5ncccc54)c(-n4c5ccccc5c5ccccc54)c3)nc(-c3c(F)c(F)c(F)c(F)c3F)n2)c(F)c1F |
| InChI | InChI=1S/C57H26F10N6/c58-45-43(46(59)50(63)53(66)49(45)62)34-26-33(69-57(70-34)44-47(60)51(64)54(67)52(65)48(44)61)27-24-41(71-35-17-6-1-12-28(35)29-13-2-7-18-36(29)71)56(73-39-21-10-5-16-32(39)55-40(73)22-11-23-68-55)42(25-27)72-37-19-8-3-14-30(37)31-15-4-9-20-38(31)72/h1-26H |
| InChIKey | MMFZGMQHMKVZOP-UHFFFAOYSA-N |
| XLogP | 15.55 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.86 |
| LogP ≤ 5 | 15.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|