C21H21N5O2 — CID 135131072
(6aR,7R,10aS)-4-methoxy-7,10a-dimethyl-8-oxo-2-(pyridin-4-ylamino)-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135131072) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is (6aR,7R,10aS)-4-methoxy-7,10a-dimethyl-8-oxo-2-(pyridin-4-ylamino)-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-4-methoxy-7,10a-dimethyl-8-oxo-2-(pyridin-4-ylamino)-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135131072 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (6aR,7R,10aS)-4-methoxy-7,10a-dimethyl-8-oxo-2-(pyridin-4-ylamino)-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | COc1nc(Nc2ccncc2)nc2c1CC[C@@H]1[C@@H](C)C(=O)C(C#N)=C[C@@]21C |
| InChI | InChI=1S/C21H21N5O2/c1-12-16-5-4-15-18(21(16,2)10-13(11-22)17(12)27)25-20(26-19(15)28-3)24-14-6-8-23-9-7-14/h6-10,12,16H,4-5H2,1-3H3,(H,23,24,25,26)/t12-,16-,21-/m1/s1 |
| InChIKey | JKUHDMHOLHDEPT-YDZGXFTCSA-N |
| XLogP | 3.11 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |