C58H31F10N5O — CID 135131089
5-[2,6-bis(2,3,4,5,6-pentafluorophenyl)pyrimidin-4-yl]-2-phenoxazin-10-yl-1-N,1-N,3-N,3-N-tetraphenylbenzene-1,3-diamine (PubChem CID 135131089) has the molecular formula C58H31F10N5O and a molecular weight of 1003.90 g/mol. Its IUPAC name is 5-[2,6-bis(2,3,4,5,6-pentafluorophenyl)pyrimidin-4-yl]-2-phenoxazin-10-yl-1-N,1-N,3-N,3-N-tetraphenylbenzene-1,3-diamine.
| Compound Name | 5-[2,6-bis(2,3,4,5,6-pentafluorophenyl)pyrimidin-4-yl]-2-phenoxazin-10-yl-1-N,1-N,3-N,3-N-tetraphenylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 135131089 |
| Molecular Formula | C58H31F10N5O |
| Molecular Weight | 1003.90 g/mol |
| Exact Mass | 1003.24 |
| IUPAC Name | 5-[2,6-bis(2,3,4,5,6-pentafluorophenyl)pyrimidin-4-yl]-2-phenoxazin-10-yl-1-N,1-N,3-N,3-N-tetraphenylbenzene-1,3-diamine |
| SMILES | Fc1c(F)c(F)c(-c2cc(-c3cc(N(c4ccccc4)c4ccccc4)c(N4c5ccccc5Oc5ccccc54)c(N(c4ccccc4)c4ccccc4)c3)nc(-c3c(F)c(F)c(F)c(F)c3F)n2)c(F)c1F |
| InChI | InChI=1S/C58H31F10N5O/c59-47-45(48(60)52(64)55(67)51(47)63)38-31-37(69-58(70-38)46-49(61)53(65)56(68)54(66)50(46)62)32-29-41(71(33-17-5-1-6-18-33)34-19-7-2-8-20-34)57(73-39-25-13-15-27-43(39)74-44-28-16-14-26-40(44)73)42(30-32)72(35-21-9-3-10-22-35)36-23-11-4-12-24-36/h1-31H |
| InChIKey | LUEAFJOCPYCQQH-UHFFFAOYSA-N |
| XLogP | 17.38 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1003.90 |
| LogP ≤ 5 | 17.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|