C81H84N6 — CID 135131181
9-[2,3-bis(3,6-ditert-butylcarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-ditert-butylcarbazole (PubChem CID 135131181) has the molecular formula C81H84N6 and a molecular weight of 1141.60 g/mol. Its IUPAC name is 9-[2,3-bis(3,6-ditert-butylcarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-ditert-butylcarbazole.
| Compound Name | 9-[2,3-bis(3,6-ditert-butylcarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-ditert-butylcarbazole |
|---|---|
| PubChem CID | 135131181 |
| Molecular Formula | C81H84N6 |
| Molecular Weight | 1141.60 g/mol |
| Exact Mass | 1140.68 |
| IUPAC Name | 9-[2,3-bis(3,6-ditert-butylcarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-ditert-butylcarbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)c1-n1c2ccc(C(C)(C)C)cc2c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C81H84N6/c1-76(2,3)52-29-35-64-58(43-52)59-44-53(77(4,5)6)30-36-65(59)85(64)70-41-51(75-83-73(49-25-21-19-22-26-49)82-74(84-75)50-27-23-20-24-28-50)42-71(86-66-37-31-54(78(7,8)9)45-60(66)61-46-55(79(10,11)12)32-38-67(61)86)72(70)87-68-39-33-56(80(13,14)15)47-62(68)63-48-57(81(16,17)18)34-40-69(63)87/h19-48H,1-18H3 |
| InChIKey | LZTQCVWUXBWPRZ-UHFFFAOYSA-N |
| XLogP | 21.95 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1141.60 |
| LogP ≤ 5 | 21.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |