C56H25F10N7 — CID 135131387
8-[4-[2,6-bis(2,3,4,5,6-pentafluorophenyl)pyrimidin-4-yl]-2,6-di(carbazol-9-yl)phenyl]-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 135131387) has the molecular formula C56H25F10N7 and a molecular weight of 985.85 g/mol. Its IUPAC name is 8-[4-[2,6-bis(2,3,4,5,6-pentafluorophenyl)pyrimidin-4-yl]-2,6-di(carbazol-9-yl)phenyl]-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 8-[4-[2,6-bis(2,3,4,5,6-pentafluorophenyl)pyrimidin-4-yl]-2,6-di(carbazol-9-yl)phenyl]-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 135131387 |
| Molecular Formula | C56H25F10N7 |
| Molecular Weight | 985.85 g/mol |
| Exact Mass | 985.20 |
| IUPAC Name | 8-[4-[2,6-bis(2,3,4,5,6-pentafluorophenyl)pyrimidin-4-yl]-2,6-di(carbazol-9-yl)phenyl]-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Fc1c(F)c(F)c(-c2cc(-c3cc(-n4c5ccccc5c5ccccc54)c(-n4c5cccnc5c5ncccc54)c(-n4c5ccccc5c5ccccc54)c3)nc(-c3c(F)c(F)c(F)c(F)c3F)n2)c(F)c1F |
| InChI | InChI=1S/C56H25F10N7/c57-43-41(44(58)48(62)51(65)47(43)61)32-25-31(69-56(70-32)42-45(59)49(63)52(66)50(64)46(42)60)26-23-39(71-33-15-5-1-11-27(33)28-12-2-6-16-34(28)71)55(73-37-19-9-21-67-53(37)54-38(73)20-10-22-68-54)40(24-26)72-35-17-7-3-13-29(35)30-14-4-8-18-36(30)72/h1-25H |
| InChIKey | JEKCYZWDRJTTPA-UHFFFAOYSA-N |
| XLogP | 14.95 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.85 |
| LogP ≤ 5 | 14.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|