C26H34ClN3O — CID 135131561
(6aR,7R,10aR)-4-chloro-6-heptyl-7,10a-dimethyl-2-pyridin-4-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one (PubChem CID 135131561) has the molecular formula C26H34ClN3O and a molecular weight of 440.03 g/mol. Its IUPAC name is (6aR,7R,10aR)-4-chloro-6-heptyl-7,10a-dimethyl-2-pyridin-4-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aR,7R,10aR)-4-chloro-6-heptyl-7,10a-dimethyl-2-pyridin-4-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 135131561 |
| Molecular Formula | C26H34ClN3O |
| Molecular Weight | 440.03 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | (6aR,7R,10aR)-4-chloro-6-heptyl-7,10a-dimethyl-2-pyridin-4-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one |
| SMILES | CCCCCCCC1Cc2c(Cl)nc(-c3ccncc3)nc2[C@]2(C)CCC(=O)[C@H](C)[C@@H]12 |
| InChI | InChI=1S/C26H34ClN3O/c1-4-5-6-7-8-9-19-16-20-23(26(3)13-10-21(31)17(2)22(19)26)29-25(30-24(20)27)18-11-14-28-15-12-18/h11-12,14-15,17,19,22H,4-10,13,16H2,1-3H3/t17-,19?,22-,26+/m0/s1 |
| InChIKey | KAXBXFTYDKWPAB-BXZAVOJSSA-N |
| XLogP | 6.60 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.03 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|