C28H28N4O2 — CID 135131706
(6aR,7R,10aS)-2-(1-acetyl-3,6-dihydro-2H-pyridin-5-yl)-7,10a-dimethyl-8-oxo-4-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135131706) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is (6aR,7R,10aS)-2-(1-acetyl-3,6-dihydro-2H-pyridin-5-yl)-7,10a-dimethyl-8-oxo-4-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-2-(1-acetyl-3,6-dihydro-2H-pyridin-5-yl)-7,10a-dimethyl-8-oxo-4-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135131706 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | (6aR,7R,10aS)-2-(1-acetyl-3,6-dihydro-2H-pyridin-5-yl)-7,10a-dimethyl-8-oxo-4-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | CC(=O)N1CCC=C(c2nc(-c3ccccc3)c3c(n2)[C@]2(C)C=C(C#N)C(=O)[C@H](C)[C@H]2CC3)C1 |
| InChI | InChI=1S/C28H28N4O2/c1-17-23-12-11-22-24(19-8-5-4-6-9-19)30-27(20-10-7-13-32(16-20)18(2)33)31-26(22)28(23,3)14-21(15-29)25(17)34/h4-6,8-10,14,17,23H,7,11-13,16H2,1-3H3/t17-,23-,28-/m1/s1 |
| InChIKey | OEKATLZCMBHDED-QVFVGHPYSA-N |
| XLogP | 4.27 |
| TPSA | 86.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |