C24H25ClN4O2 — CID 135131726
(6'aR,7'R,10'aR)-4'-chloro-7',10'a-dimethyl-2'-quinazolin-4-ylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline] (PubChem CID 135131726) has the molecular formula C24H25ClN4O2 and a molecular weight of 436.94 g/mol. Its IUPAC name is (6'aR,7'R,10'aR)-4'-chloro-7',10'a-dimethyl-2'-quinazolin-4-ylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline].
| Compound Name | (6'aR,7'R,10'aR)-4'-chloro-7',10'a-dimethyl-2'-quinazolin-4-ylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline] |
|---|---|
| PubChem CID | 135131726 |
| Molecular Formula | C24H25ClN4O2 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (6'aR,7'R,10'aR)-4'-chloro-7',10'a-dimethyl-2'-quinazolin-4-ylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline] |
| SMILES | C[C@@H]1[C@H]2CCc3c(Cl)nc(-c4ncnc5ccccc45)nc3[C@]2(C)CCC12OCCO2 |
| InChI | InChI=1S/C24H25ClN4O2/c1-14-17-8-7-16-20(23(17,2)9-10-24(14)30-11-12-31-24)28-22(29-21(16)25)19-15-5-3-4-6-18(15)26-13-27-19/h3-6,13-14,17H,7-12H2,1-2H3/t14-,17-,23-/m1/s1 |
| InChIKey | XCEGOEZPDWWREQ-KFOHMRLHSA-N |
| XLogP | 4.73 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |