C31H31FN4O3 — CID 135131735
ethyl 3-[4-[(6aR,7R,11aR)-4-(2-fluorophenyl)-7,11a-dimethyl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazolin-2-yl]-2-pyridinyl]propanoate (PubChem CID 135131735) has the molecular formula C31H31FN4O3 and a molecular weight of 526.61 g/mol. Its IUPAC name is ethyl 3-[4-[(6aR,7R,11aR)-4-(2-fluorophenyl)-7,11a-dimethyl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazolin-2-yl]-2-pyridinyl]propanoate.
| Compound Name | ethyl 3-[4-[(6aR,7R,11aR)-4-(2-fluorophenyl)-7,11a-dimethyl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazolin-2-yl]-2-pyridinyl]propanoate |
|---|---|
| PubChem CID | 135131735 |
| Molecular Formula | C31H31FN4O3 |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | ethyl 3-[4-[(6aR,7R,11aR)-4-(2-fluorophenyl)-7,11a-dimethyl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazolin-2-yl]-2-pyridinyl]propanoate |
| SMILES | CCOC(=O)CCc1cc(-c2nc(-c3ccccc3F)c3c(n2)[C@]2(C)Cc4cnoc4[C@H](C)[C@H]2CC3)ccn1 |
| InChI | InChI=1S/C31H31FN4O3/c1-4-38-26(37)12-9-21-15-19(13-14-33-21)30-35-27(22-7-5-6-8-25(22)32)23-10-11-24-18(2)28-20(17-34-39-28)16-31(24,3)29(23)36-30/h5-8,13-15,17-18,24H,4,9-12,16H2,1-3H3/t18-,24-,31-/m1/s1 |
| InChIKey | IOYFSBBFSBZDIB-IEEYFSLBSA-N |
| XLogP | 6.01 |
| TPSA | 91.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |