C31H24F2N4O — CID 135131751
(6aR,7R,10aS)-2-[2-(fluoromethyl)quinolin-4-yl]-4-(2-fluorophenyl)-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135131751) has the molecular formula C31H24F2N4O and a molecular weight of 506.56 g/mol. Its IUPAC name is (6aR,7R,10aS)-2-[2-(fluoromethyl)quinolin-4-yl]-4-(2-fluorophenyl)-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-2-[2-(fluoromethyl)quinolin-4-yl]-4-(2-fluorophenyl)-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135131751 |
| Molecular Formula | C31H24F2N4O |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | (6aR,7R,10aS)-2-[2-(fluoromethyl)quinolin-4-yl]-4-(2-fluorophenyl)-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3nc(-c4cc(CF)nc5ccccc45)nc(-c4ccccc4F)c3CC[C@H]12 |
| InChI | InChI=1S/C31H24F2N4O/c1-17-24-12-11-22-27(21-8-3-5-9-25(21)33)36-30(37-29(22)31(24,2)14-18(16-34)28(17)38)23-13-19(15-32)35-26-10-6-4-7-20(23)26/h3-10,13-14,17,24H,11-12,15H2,1-2H3/t17-,24-,31-/m1/s1 |
| InChIKey | ZNZCNWICGPHWDV-HXIGGIJRSA-N |
| XLogP | 6.46 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |