C30H25FN4O — CID 135131766
(6aR,7R,10aR)-4-(2-fluorophenyl)-7,10a-dimethyl-8-oxo-2-quinolin-4-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135131766) has the molecular formula C30H25FN4O and a molecular weight of 476.56 g/mol. Its IUPAC name is (6aR,7R,10aR)-4-(2-fluorophenyl)-7,10a-dimethyl-8-oxo-2-quinolin-4-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aR)-4-(2-fluorophenyl)-7,10a-dimethyl-8-oxo-2-quinolin-4-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135131766 |
| Molecular Formula | C30H25FN4O |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | (6aR,7R,10aR)-4-(2-fluorophenyl)-7,10a-dimethyl-8-oxo-2-quinolin-4-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)C[C@@]2(C)c3nc(-c4ccnc5ccccc45)nc(-c4ccccc4F)c3CC[C@H]12 |
| InChI | InChI=1S/C30H25FN4O/c1-17-23-12-11-22-26(21-8-3-5-9-24(21)31)34-29(20-13-14-33-25-10-6-4-7-19(20)25)35-28(22)30(23,2)15-18(16-32)27(17)36/h3-10,13-14,17-18,23H,11-12,15H2,1-2H3/t17-,18?,23-,30-/m1/s1 |
| InChIKey | DPOPCEZVFMGRTH-VOEIZJJQSA-N |
| XLogP | 6.07 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|